About ethane;(2S)-2-phenylpropan-1-ol
ethane;(2S)-2-phenylpropan-1-ol (PubChem CID 142206535) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is ethane;(2S)-2-phenylpropan-1-ol.
Molecular Properties
| Compound Name | ethane;(2S)-2-phenylpropan-1-ol |
| PubChem CID | 142206535 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | ethane;(2S)-2-phenylpropan-1-ol |
| SMILES | CC.C[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C9H12O.C2H6/c1-8(7-10)9-5-3-2-4-6-9;1-2/h2-6,8,10H,7H2,1H3;1-2H3/t8-;/m1./s1 |
| InChIKey | RJPIQQSZUKNTMY-DDWIOCJRSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(2S)-2-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2S)-2-phenylpropan-1-ol?
The IUPAC name of ethane;(2S)-2-phenylpropan-1-ol (CID 142206535) is ethane;(2S)-2-phenylpropan-1-ol.
What is the SMILES notation for ethane;(2S)-2-phenylpropan-1-ol?
The canonical SMILES for ethane;(2S)-2-phenylpropan-1-ol is CC.C[C@H](CO)c1ccccc1.
What is the InChIKey of ethane;(2S)-2-phenylpropan-1-ol?
The InChIKey is RJPIQQSZUKNTMY-DDWIOCJRSA-N. The full InChI is InChI=1S/C9H12O.C2H6/c1-8(7-10)9-5-3-2-4-6-9;1-2/h2-6,8,10H,7H2,1H3;1-2H3/t8-;/m1./s1.
What are the key properties of ethane;(2S)-2-phenylpropan-1-ol?
ethane;(2S)-2-phenylpropan-1-ol has a molecular weight of 166.26 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2S)-2-phenylpropan-1-ol is sourced from PubChem (CID 142206535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).