About bis(2-phenyloxirane);2-phenylpropan-1-ol
bis(2-phenyloxirane);2-phenylpropan-1-ol (PubChem CID 161299790) has the molecular formula C25H28O3
and a molecular weight of 376.50 g/mol. Its IUPAC name is bis(2-phenyloxirane);2-phenylpropan-1-ol.
Molecular Properties
| Compound Name | bis(2-phenyloxirane);2-phenylpropan-1-ol |
| PubChem CID | 161299790 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | bis(2-phenyloxirane);2-phenylpropan-1-ol |
| SMILES | CC(CO)c1ccccc1.c1ccc(C2CO2)cc1.c1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C9H12O.2C8H8O/c1-8(7-10)9-5-3-2-4-6-9;2*1-2-4-7(5-3-1)8-6-9-8/h2-6,8,10H,7H2,1H3;2*1-5,8H,6H2 |
| InChIKey | VHLLWEFNJGQDBP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bis(2-phenyloxirane);2-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-phenyloxirane);2-phenylpropan-1-ol?
The IUPAC name of bis(2-phenyloxirane);2-phenylpropan-1-ol (CID 161299790) is bis(2-phenyloxirane);2-phenylpropan-1-ol.
What is the SMILES notation for bis(2-phenyloxirane);2-phenylpropan-1-ol?
The canonical SMILES for bis(2-phenyloxirane);2-phenylpropan-1-ol is CC(CO)c1ccccc1.c1ccc(C2CO2)cc1.c1ccc(C2CO2)cc1.
What is the InChIKey of bis(2-phenyloxirane);2-phenylpropan-1-ol?
The InChIKey is VHLLWEFNJGQDBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.2C8H8O/c1-8(7-10)9-5-3-2-4-6-9;2*1-2-4-7(5-3-1)8-6-9-8/h2-6,8,10H,7H2,1H3;2*1-5,8H,6H2.
What are the key properties of bis(2-phenyloxirane);2-phenylpropan-1-ol?
bis(2-phenyloxirane);2-phenylpropan-1-ol has a molecular weight of 376.50 g/mol, XLogP of 5.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-phenyloxirane);2-phenylpropan-1-ol is sourced from PubChem (CID 161299790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).