C20H18O2 — CID 7000031
(2S)-1,1,2-triphenylethane-1,2-diol (PubChem CID 7000031) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2S)-1,1,2-triphenylethane-1,2-diol.
| Compound Name | (2S)-1,1,2-triphenylethane-1,2-diol |
|---|---|
| PubChem CID | 7000031 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2S)-1,1,2-triphenylethane-1,2-diol |
| SMILES | O[C@@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O2/c21-19(16-10-4-1-5-11-16)20(22,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19,21-22H/t19-/m0/s1 |
| InChIKey | GWVWUZJOQHWMFB-IBGZPJMESA-N |
| XLogP | 3.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |