C10H14O2 — CID 18417931
3-phenylbutane-1,1-diol (PubChem CID 18417931) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-phenylbutane-1,1-diol.
| Compound Name | 3-phenylbutane-1,1-diol |
|---|---|
| PubChem CID | 18417931 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 3-phenylbutane-1,1-diol |
| SMILES | CC(CC(O)O)c1ccccc1 |
| InChI | InChI=1S/C10H14O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8,10-12H,7H2,1H3 |
| InChIKey | MPRRVQZSIQBRHC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|