About barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid
barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid (PubChem CID 174968808) has the molecular formula C12H16BaO4
and a molecular weight of 361.58 g/mol. Its IUPAC name is barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid.
Molecular Properties
| Compound Name | barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid |
| PubChem CID | 174968808 |
| Molecular Formula | C12H16BaO4 |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid |
| SMILES | CC(CC(C(=O)O)C(=O)O)c1ccccc1.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C12H14O4.Ba.2H/c1-8(9-5-3-2-4-6-9)7-10(11(13)14)12(15)16;;;/h2-6,8,10H,7H2,1H3,(H,13,14)(H,15,16);;;/q;+2;2*-1 |
| InChIKey | VPDNDWDKEFIDJS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid?
The IUPAC name of barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid (CID 174968808) is barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid.
What is the SMILES notation for barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid?
The canonical SMILES for barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid is CC(CC(C(=O)O)C(=O)O)c1ccccc1.[Ba+2].[H-].[H-].
What is the InChIKey of barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid?
The InChIKey is VPDNDWDKEFIDJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4.Ba.2H/c1-8(9-5-3-2-4-6-9)7-10(11(13)14)12(15)16;;;/h2-6,8,10H,7H2,1H3,(H,13,14)(H,15,16);;;/q;+2;2*-1.
What are the key properties of barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid?
barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid has a molecular weight of 361.58 g/mol, XLogP of 1.81, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);hydride;2-(2-phenylpropyl)propanedioic acid is sourced from PubChem (CID 174968808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).