C24H24O2 — CID 142061345
(2R)-4-phenyl-2-[(4-phenylphenyl)methyl]pentanoic acid (PubChem CID 142061345) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is (2R)-4-phenyl-2-[(4-phenylphenyl)methyl]pentanoic acid.
| Compound Name | (2R)-4-phenyl-2-[(4-phenylphenyl)methyl]pentanoic acid |
|---|---|
| PubChem CID | 142061345 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2R)-4-phenyl-2-[(4-phenylphenyl)methyl]pentanoic acid |
| SMILES | CC(CC(Cc1ccc(-c2ccccc2)cc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H24O2/c1-18(20-8-4-2-5-9-20)16-23(24(25)26)17-19-12-14-22(15-13-19)21-10-6-3-7-11-21/h2-15,18,23H,16-17H2,1H3,(H,25,26) |
| InChIKey | SZTMYEQDFUKDTQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |