C13H18O2 — CID 15416243
2-benzyl-4-methylpentanoic acid (PubChem CID 15416243) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-benzyl-4-methylpentanoic acid.
| Compound Name | 2-benzyl-4-methylpentanoic acid |
|---|---|
| PubChem CID | 15416243 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-benzyl-4-methylpentanoic acid |
| SMILES | CC(C)CC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H18O2/c1-10(2)8-12(13(14)15)9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,14,15) |
| InChIKey | OSPILOQOWQWUCH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |