C13H15NO6 — CID 18594451
(4R)-2-benzyl-4-(carboxyamino)pentanedioic acid (PubChem CID 18594451) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is (4R)-2-benzyl-4-(carboxyamino)pentanedioic acid.
| Compound Name | (4R)-2-benzyl-4-(carboxyamino)pentanedioic acid |
|---|---|
| PubChem CID | 18594451 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (4R)-2-benzyl-4-(carboxyamino)pentanedioic acid |
| SMILES | O=C(O)N[C@H](CC(Cc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H15NO6/c15-11(16)9(6-8-4-2-1-3-5-8)7-10(12(17)18)14-13(19)20/h1-5,9-10,14H,6-7H2,(H,15,16)(H,17,18)(H,19,20)/t9?,10-/m1/s1 |
| InChIKey | BTAMALUTDPYLIY-QVDQXJPCSA-N |
| XLogP | 1.04 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |