C11H10Cl3NO3 — CID 20638357
[(2S)-4,4,4-trichloro-3-oxo-1-phenylbutan-2-yl]carbamic acid (PubChem CID 20638357) has the molecular formula C11H10Cl3NO3 and a molecular weight of 310.56 g/mol. Its IUPAC name is [(2S)-4,4,4-trichloro-3-oxo-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S)-4,4,4-trichloro-3-oxo-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 20638357 |
| Molecular Formula | C11H10Cl3NO3 |
| Molecular Weight | 310.56 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | [(2S)-4,4,4-trichloro-3-oxo-1-phenylbutan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccccc1)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl3NO3/c12-11(13,14)9(16)8(15-10(17)18)6-7-4-2-1-3-5-7/h1-5,8,15H,6H2,(H,17,18)/t8-/m0/s1 |
| InChIKey | HQNASXCDIXONOS-QMMMGPOBSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|