C13H12Cl3NO3 — CID 23247360
3-phenyl-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]propanoic acid (PubChem CID 23247360) has the molecular formula C13H12Cl3NO3 and a molecular weight of 336.60 g/mol. Its IUPAC name is 3-phenyl-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]propanoic acid.
| Compound Name | 3-phenyl-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23247360 |
| Molecular Formula | C13H12Cl3NO3 |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 3-phenyl-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)N/C=C\C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H12Cl3NO3/c14-13(15,16)11(18)6-7-17-10(12(19)20)8-9-4-2-1-3-5-9/h1-7,10,17H,8H2,(H,19,20)/b7-6- |
| InChIKey | ISQMWAMUIXWPAR-SREVYHEPSA-N |
| XLogP | 2.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|