C14H14Cl3NO3 — CID 101210331
methyl (2S)-3-phenyl-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]propanoate (PubChem CID 101210331) has the molecular formula C14H14Cl3NO3 and a molecular weight of 350.63 g/mol. Its IUPAC name is methyl (2S)-3-phenyl-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]propanoate.
| Compound Name | methyl (2S)-3-phenyl-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]propanoate |
|---|---|
| PubChem CID | 101210331 |
| Molecular Formula | C14H14Cl3NO3 |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | methyl (2S)-3-phenyl-2-[[(Z)-4,4,4-trichloro-3-oxobut-1-enyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)N/C=C\C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H14Cl3NO3/c1-21-13(20)11(9-10-5-3-2-4-6-10)18-8-7-12(19)14(15,16)17/h2-8,11,18H,9H2,1H3/b8-7-/t11-/m0/s1 |
| InChIKey | XTHDRWHCWNZHMV-TVRMLOFPSA-N |
| XLogP | 2.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|