C25H21F3N2O2 — CID 6134525
3-phenyl-N-(4-phenylphenyl)-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide (PubChem CID 6134525) has the molecular formula C25H21F3N2O2 and a molecular weight of 438.45 g/mol. Its IUPAC name is 3-phenyl-N-(4-phenylphenyl)-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide.
| Compound Name | 3-phenyl-N-(4-phenylphenyl)-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide |
|---|---|
| PubChem CID | 6134525 |
| Molecular Formula | C25H21F3N2O2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 3-phenyl-N-(4-phenylphenyl)-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)C(Cc1ccccc1)N/C=C/C(=O)C(F)(F)F |
| InChI | InChI=1S/C25H21F3N2O2/c26-25(27,28)23(31)15-16-29-22(17-18-7-3-1-4-8-18)24(32)30-21-13-11-20(12-14-21)19-9-5-2-6-10-19/h1-16,22,29H,17H2,(H,30,32)/b16-15+ |
| InChIKey | WQRUQICLNHTQQI-FOCLMDBBSA-N |
| XLogP | 5.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|