C19H18F3N3O2 — CID 6134522
N-(3-methyl-2-pyridinyl)-3-phenyl-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide (PubChem CID 6134522) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is N-(3-methyl-2-pyridinyl)-3-phenyl-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide.
| Compound Name | N-(3-methyl-2-pyridinyl)-3-phenyl-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide |
|---|---|
| PubChem CID | 6134522 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(3-methyl-2-pyridinyl)-3-phenyl-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide |
| SMILES | Cc1cccnc1NC(=O)C(Cc1ccccc1)N/C=C/C(=O)C(F)(F)F |
| InChI | InChI=1S/C19H18F3N3O2/c1-13-6-5-10-24-17(13)25-18(27)15(12-14-7-3-2-4-8-14)23-11-9-16(26)19(20,21)22/h2-11,15,23H,12H2,1H3,(H,24,25,27)/b11-9+ |
| InChIKey | WEYGRPJUVAVMQN-PKNBQFBNSA-N |
| XLogP | 3.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|