C19H17F3N2O2 — CID 6134355
N,3-diphenyl-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide (PubChem CID 6134355) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is N,3-diphenyl-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide.
| Compound Name | N,3-diphenyl-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide |
|---|---|
| PubChem CID | 6134355 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N,3-diphenyl-2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]propanamide |
| SMILES | O=C(Nc1ccccc1)C(Cc1ccccc1)N/C=C/C(=O)C(F)(F)F |
| InChI | InChI=1S/C19H17F3N2O2/c20-19(21,22)17(25)11-12-23-16(13-14-7-3-1-4-8-14)18(26)24-15-9-5-2-6-10-15/h1-12,16,23H,13H2,(H,24,26)/b12-11+ |
| InChIKey | PTEUIHJNDCUINQ-VAWYXSNFSA-N |
| XLogP | 3.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|