C19H16F3N3O4 — CID 4509854
N-(3-nitrophenyl)-3-phenyl-2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]propanamide (PubChem CID 4509854) has the molecular formula C19H16F3N3O4 and a molecular weight of 407.35 g/mol. Its IUPAC name is N-(3-nitrophenyl)-3-phenyl-2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]propanamide.
| Compound Name | N-(3-nitrophenyl)-3-phenyl-2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]propanamide |
|---|---|
| PubChem CID | 4509854 |
| Molecular Formula | C19H16F3N3O4 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-(3-nitrophenyl)-3-phenyl-2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]propanamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)C(Cc1ccccc1)NC=CC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H16F3N3O4/c20-19(21,22)17(26)9-10-23-16(11-13-5-2-1-3-6-13)18(27)24-14-7-4-8-15(12-14)25(28)29/h1-10,12,16,23H,11H2,(H,24,27) |
| InChIKey | UCQJYJVYJAPBKZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|