C21H17N5O5S2 — CID 46254122
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-(3-nitrophenyl)-3-phenylpropanamide (PubChem CID 46254122) has the molecular formula C21H17N5O5S2 and a molecular weight of 483.53 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-(3-nitrophenyl)-3-phenylpropanamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-(3-nitrophenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 46254122 |
| Molecular Formula | C21H17N5O5S2 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-(3-nitrophenyl)-3-phenylpropanamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)C(Cc1ccccc1)NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C21H17N5O5S2/c27-21(22-15-8-4-9-16(13-15)26(28)29)18(12-14-6-2-1-3-7-14)25-33(30,31)19-11-5-10-17-20(19)24-32-23-17/h1-11,13,18,25H,12H2,(H,22,27) |
| InChIKey | AIBIRFRKTAXTCX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|