C21H18FN3O5S — CID 28541083
(2S)-2-[(4-fluorophenyl)sulfonylamino]-N-(3-nitrophenyl)-3-phenylpropanamide (PubChem CID 28541083) has the molecular formula C21H18FN3O5S and a molecular weight of 443.46 g/mol. Its IUPAC name is (2S)-2-[(4-fluorophenyl)sulfonylamino]-N-(3-nitrophenyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-[(4-fluorophenyl)sulfonylamino]-N-(3-nitrophenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 28541083 |
| Molecular Formula | C21H18FN3O5S |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | (2S)-2-[(4-fluorophenyl)sulfonylamino]-N-(3-nitrophenyl)-3-phenylpropanamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H18FN3O5S/c22-16-9-11-19(12-10-16)31(29,30)24-20(13-15-5-2-1-3-6-15)21(26)23-17-7-4-8-18(14-17)25(27)28/h1-12,14,20,24H,13H2,(H,23,26)/t20-/m0/s1 |
| InChIKey | RBWNTLWKCKKGPH-FQEVSTJZSA-N |
| XLogP | 3.26 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|