C11H10F3NO — CID 14691051
(Z)-4-(benzylamino)-1,1,1-trifluorobut-3-en-2-one (PubChem CID 14691051) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is (Z)-4-(benzylamino)-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | (Z)-4-(benzylamino)-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 14691051 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (Z)-4-(benzylamino)-1,1,1-trifluorobut-3-en-2-one |
| SMILES | O=C(/C=C\NCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO/c12-11(13,14)10(16)6-7-15-8-9-4-2-1-3-5-9/h1-7,15H,8H2/b7-6- |
| InChIKey | ZVATZGWONTYIIZ-SREVYHEPSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|