C18H17F3N2O — CID 3706822
N-benzyl-3-(benzylamino)-4,4,4-trifluorobut-2-enamide (PubChem CID 3706822) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is N-benzyl-3-(benzylamino)-4,4,4-trifluorobut-2-enamide.
| Compound Name | N-benzyl-3-(benzylamino)-4,4,4-trifluorobut-2-enamide |
|---|---|
| PubChem CID | 3706822 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-benzyl-3-(benzylamino)-4,4,4-trifluorobut-2-enamide |
| SMILES | O=C(C=C(NCc1ccccc1)C(F)(F)F)NCc1ccccc1 |
| InChI | InChI=1S/C18H17F3N2O/c19-18(20,21)16(22-12-14-7-3-1-4-8-14)11-17(24)23-13-15-9-5-2-6-10-15/h1-11,22H,12-13H2,(H,23,24) |
| InChIKey | RAKFSUJBMQCPHI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|