C19H19NO — CID 102036043
(2Z,4E)-N-benzyl-3-methyl-5-phenylpenta-2,4-dienamide (PubChem CID 102036043) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is (2Z,4E)-N-benzyl-3-methyl-5-phenylpenta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-benzyl-3-methyl-5-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 102036043 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (2Z,4E)-N-benzyl-3-methyl-5-phenylpenta-2,4-dienamide |
| SMILES | CC(=C/C(=O)NCc1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H19NO/c1-16(12-13-17-8-4-2-5-9-17)14-19(21)20-15-18-10-6-3-7-11-18/h2-14H,15H2,1H3,(H,20,21)/b13-12+,16-14- |
| InChIKey | ONDNXMYWTJBGBN-LIACPWMRSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|