C20H20N2O2 — CID 102438932
(2Z,4Z)-N,N'-dibenzylhexa-2,4-dienediamide (PubChem CID 102438932) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2Z,4Z)-N,N'-dibenzylhexa-2,4-dienediamide.
| Compound Name | (2Z,4Z)-N,N'-dibenzylhexa-2,4-dienediamide |
|---|---|
| PubChem CID | 102438932 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2Z,4Z)-N,N'-dibenzylhexa-2,4-dienediamide |
| SMILES | O=C(/C=C\C=C/C(=O)NCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c23-19(21-15-17-9-3-1-4-10-17)13-7-8-14-20(24)22-16-18-11-5-2-6-12-18/h1-14H,15-16H2,(H,21,23)(H,22,24)/b13-7-,14-8- |
| InChIKey | MIBTYCQLCCBSDV-PVRNWPCDSA-N |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|