About N'-benzyloxamide
N'-benzyloxamide (PubChem CID 561416) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is N'-benzyloxamide.
Molecular Properties
| Compound Name | N'-benzyloxamide |
| PubChem CID | 561416 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | N'-benzyloxamide |
| SMILES | NC(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C9H10N2O2/c10-8(12)9(13)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12)(H,11,13) |
| InChIKey | QTLZZEJLDIJMQW-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyloxamide?
The IUPAC name of N'-benzyloxamide (CID 561416) is N'-benzyloxamide.
What is the SMILES notation for N'-benzyloxamide?
The canonical SMILES for N'-benzyloxamide is NC(=O)C(=O)NCc1ccccc1.
What is the InChIKey of N'-benzyloxamide?
The InChIKey is QTLZZEJLDIJMQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c10-8(12)9(13)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12)(H,11,13).
What are the key properties of N'-benzyloxamide?
N'-benzyloxamide has a molecular weight of 178.19 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyloxamide is sourced from PubChem (CID 561416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).