C16H20O — CID 13383969
(5E,7E)-2,6-dimethyl-8-phenylocta-5,7-dien-4-one (PubChem CID 13383969) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (5E,7E)-2,6-dimethyl-8-phenylocta-5,7-dien-4-one.
| Compound Name | (5E,7E)-2,6-dimethyl-8-phenylocta-5,7-dien-4-one |
|---|---|
| PubChem CID | 13383969 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (5E,7E)-2,6-dimethyl-8-phenylocta-5,7-dien-4-one |
| SMILES | CC(/C=C/c1ccccc1)=C\C(=O)CC(C)C |
| InChI | InChI=1S/C16H20O/c1-13(2)11-16(17)12-14(3)9-10-15-7-5-4-6-8-15/h4-10,12-13H,11H2,1-3H3/b10-9+,14-12+ |
| InChIKey | DIVPGYBEWUISID-MSEVIDPPSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|