C21H24O — CID 54602474
(Z)-6,6-dimethyl-1,5-diphenylhept-1-en-3-one (PubChem CID 54602474) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is (Z)-6,6-dimethyl-1,5-diphenylhept-1-en-3-one.
| Compound Name | (Z)-6,6-dimethyl-1,5-diphenylhept-1-en-3-one |
|---|---|
| PubChem CID | 54602474 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (Z)-6,6-dimethyl-1,5-diphenylhept-1-en-3-one |
| SMILES | CC(C)(C)C(CC(=O)/C=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O/c1-21(2,3)20(18-12-8-5-9-13-18)16-19(22)15-14-17-10-6-4-7-11-17/h4-15,20H,16H2,1-3H3/b15-14- |
| InChIKey | FZRMCJWOUKRDIU-PFONDFGASA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|