C22H25NO — CID 92522992
(Z,5R)-1,5-diphenyl-5-piperidin-1-ylpent-1-en-3-one (PubChem CID 92522992) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is (Z,5R)-1,5-diphenyl-5-piperidin-1-ylpent-1-en-3-one.
| Compound Name | (Z,5R)-1,5-diphenyl-5-piperidin-1-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 92522992 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (Z,5R)-1,5-diphenyl-5-piperidin-1-ylpent-1-en-3-one |
| SMILES | O=C(/C=C\c1ccccc1)C[C@H](c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C22H25NO/c24-21(15-14-19-10-4-1-5-11-19)18-22(20-12-6-2-7-13-20)23-16-8-3-9-17-23/h1-2,4-7,10-15,22H,3,8-9,16-18H2/b15-14-/t22-/m1/s1 |
| InChIKey | GMHXCYBKRIQGOF-KSAKKHMLSA-N |
| XLogP | 4.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|