C18H27NO2 — CID 102034056
N-(2,2-dimethylpropanoyl)-4,4-dimethyl-3-phenylpentanamide (PubChem CID 102034056) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-(2,2-dimethylpropanoyl)-4,4-dimethyl-3-phenylpentanamide.
| Compound Name | N-(2,2-dimethylpropanoyl)-4,4-dimethyl-3-phenylpentanamide |
|---|---|
| PubChem CID | 102034056 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-(2,2-dimethylpropanoyl)-4,4-dimethyl-3-phenylpentanamide |
| SMILES | CC(C)(C)C(=O)NC(=O)CC(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C18H27NO2/c1-17(2,3)14(13-10-8-7-9-11-13)12-15(20)19-16(21)18(4,5)6/h7-11,14H,12H2,1-6H3,(H,19,20,21) |
| InChIKey | WMGMDYUWZMNKBG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |