C13H19NO2 — CID 85222036
4-hydroxy-N,4-dimethyl-3-phenylpentanamide (PubChem CID 85222036) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-hydroxy-N,4-dimethyl-3-phenylpentanamide.
| Compound Name | 4-hydroxy-N,4-dimethyl-3-phenylpentanamide |
|---|---|
| PubChem CID | 85222036 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-hydroxy-N,4-dimethyl-3-phenylpentanamide |
| SMILES | CNC(=O)CC(c1ccccc1)C(C)(C)O |
| InChI | InChI=1S/C13H19NO2/c1-13(2,16)11(9-12(15)14-3)10-7-5-4-6-8-10/h4-8,11,16H,9H2,1-3H3,(H,14,15) |
| InChIKey | ODPISIRJDJEMEO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |