C18H17NO — CID 135041577
N-methyl-3,5-diphenylpent-4-ynamide (PubChem CID 135041577) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is N-methyl-3,5-diphenylpent-4-ynamide.
| Compound Name | N-methyl-3,5-diphenylpent-4-ynamide |
|---|---|
| PubChem CID | 135041577 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-methyl-3,5-diphenylpent-4-ynamide |
| SMILES | CNC(=O)CC(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17NO/c1-19-18(20)14-17(16-10-6-3-7-11-16)13-12-15-8-4-2-5-9-15/h2-11,17H,14H2,1H3,(H,19,20) |
| InChIKey | ONWWBDDZMNGBMZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|