C18H12ClF3O — CID 162539706
(4R)-6-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylhex-5-yn-2-one (PubChem CID 162539706) has the molecular formula C18H12ClF3O and a molecular weight of 336.74 g/mol. Its IUPAC name is (4R)-6-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylhex-5-yn-2-one.
| Compound Name | (4R)-6-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylhex-5-yn-2-one |
|---|---|
| PubChem CID | 162539706 |
| Molecular Formula | C18H12ClF3O |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (4R)-6-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylhex-5-yn-2-one |
| SMILES | O=C(C[C@@H](C#Cc1ccc(Cl)cc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H12ClF3O/c19-16-10-7-13(8-11-16)6-9-15(12-17(23)18(20,21)22)14-4-2-1-3-5-14/h1-5,7-8,10-11,15H,12H2/t15-/m1/s1 |
| InChIKey | JQKVEBCHJPKRDL-OAHLLOKOSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|