C18H14F2O — CID 134949108
(4R)-1,1-difluoro-4,6-diphenylhex-5-yn-2-one (PubChem CID 134949108) has the molecular formula C18H14F2O and a molecular weight of 284.31 g/mol. Its IUPAC name is (4R)-1,1-difluoro-4,6-diphenylhex-5-yn-2-one.
| Compound Name | (4R)-1,1-difluoro-4,6-diphenylhex-5-yn-2-one |
|---|---|
| PubChem CID | 134949108 |
| Molecular Formula | C18H14F2O |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (4R)-1,1-difluoro-4,6-diphenylhex-5-yn-2-one |
| SMILES | O=C(C[C@@H](C#Cc1ccccc1)c1ccccc1)C(F)F |
| InChI | InChI=1S/C18H14F2O/c19-18(20)17(21)13-16(15-9-5-2-6-10-15)12-11-14-7-3-1-4-8-14/h1-10,16,18H,13H2/t16-/m1/s1 |
| InChIKey | SVLSXXXLHHXPKJ-MRXNPFEDSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|