C19H17N — CID 138911214
(5R)-5,7-diphenylhept-6-ynenitrile (PubChem CID 138911214) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is (5R)-5,7-diphenylhept-6-ynenitrile.
| Compound Name | (5R)-5,7-diphenylhept-6-ynenitrile |
|---|---|
| PubChem CID | 138911214 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (5R)-5,7-diphenylhept-6-ynenitrile |
| SMILES | N#CCCC[C@@H](C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N/c20-16-8-7-13-19(18-11-5-2-6-12-18)15-14-17-9-3-1-4-10-17/h1-6,9-12,19H,7-8,13H2/t19-/m0/s1 |
| InChIKey | VVHAJNSSUAUERX-IBGZPJMESA-N |
| XLogP | 4.52 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|