C20H22N4 — CID 58650644
3-[[(1R,2S)-2-(2-cyanoethylamino)-1,2-diphenylethyl]amino]propanenitrile (PubChem CID 58650644) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-[[(1R,2S)-2-(2-cyanoethylamino)-1,2-diphenylethyl]amino]propanenitrile.
| Compound Name | 3-[[(1R,2S)-2-(2-cyanoethylamino)-1,2-diphenylethyl]amino]propanenitrile |
|---|---|
| PubChem CID | 58650644 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-[[(1R,2S)-2-(2-cyanoethylamino)-1,2-diphenylethyl]amino]propanenitrile |
| SMILES | N#CCCN[C@H](c1ccccc1)[C@@H](NCCC#N)c1ccccc1 |
| InChI | InChI=1S/C20H22N4/c21-13-7-15-23-19(17-9-3-1-4-10-17)20(24-16-8-14-22)18-11-5-2-6-12-18/h1-6,9-12,19-20,23-24H,7-8,15-16H2/t19-,20+ |
| InChIKey | UOSGBHIGLINCHD-BGYRXZFFSA-N |
| XLogP | 3.48 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|