C18H20N2O — CID 66751438
3-[[(1R)-1-hydroxy-1,3-diphenylpropan-2-yl]amino]propanenitrile (PubChem CID 66751438) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-[[(1R)-1-hydroxy-1,3-diphenylpropan-2-yl]amino]propanenitrile.
| Compound Name | 3-[[(1R)-1-hydroxy-1,3-diphenylpropan-2-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 66751438 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-[[(1R)-1-hydroxy-1,3-diphenylpropan-2-yl]amino]propanenitrile |
| SMILES | N#CCCNC(Cc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c19-12-7-13-20-17(14-15-8-3-1-4-9-15)18(21)16-10-5-2-6-11-16/h1-6,8-11,17-18,20-21H,7,13-14H2/t17?,18-/m1/s1 |
| InChIKey | CODGDZZAKFYJEM-QRWMCTBCSA-N |
| XLogP | 2.83 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|