C13H18N2 — CID 79007282
3-(1-phenylbutan-2-ylamino)propanenitrile (PubChem CID 79007282) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-(1-phenylbutan-2-ylamino)propanenitrile.
| Compound Name | 3-(1-phenylbutan-2-ylamino)propanenitrile |
|---|---|
| PubChem CID | 79007282 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-(1-phenylbutan-2-ylamino)propanenitrile |
| SMILES | CCC(Cc1ccccc1)NCCC#N |
| InChI | InChI=1S/C13H18N2/c1-2-13(15-10-6-9-14)11-12-7-4-3-5-8-12/h3-5,7-8,13,15H,2,6,10-11H2,1H3 |
| InChIKey | HAMWHSHOYPSSDM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|