C16H21NS — CID 79007188
1-phenyl-N-(2-thiophen-2-ylethyl)butan-2-amine (PubChem CID 79007188) has the molecular formula C16H21NS and a molecular weight of 259.42 g/mol. Its IUPAC name is 1-phenyl-N-(2-thiophen-2-ylethyl)butan-2-amine.
| Compound Name | 1-phenyl-N-(2-thiophen-2-ylethyl)butan-2-amine |
|---|---|
| PubChem CID | 79007188 |
| Molecular Formula | C16H21NS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-phenyl-N-(2-thiophen-2-ylethyl)butan-2-amine |
| SMILES | CCC(Cc1ccccc1)NCCc1cccs1 |
| InChI | InChI=1S/C16H21NS/c1-2-15(13-14-7-4-3-5-8-14)17-11-10-16-9-6-12-18-16/h3-9,12,15,17H,2,10-11,13H2,1H3 |
| InChIKey | BVEPLHLNEVUBBC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |