C27H26NO2P — CID 23241767
(1R,2S)-2-(diphenylphosphorylamino)-1,3-diphenylpropan-1-ol (PubChem CID 23241767) has the molecular formula C27H26NO2P and a molecular weight of 427.48 g/mol. Its IUPAC name is (1R,2S)-2-(diphenylphosphorylamino)-1,3-diphenylpropan-1-ol.
| Compound Name | (1R,2S)-2-(diphenylphosphorylamino)-1,3-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 23241767 |
| Molecular Formula | C27H26NO2P |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (1R,2S)-2-(diphenylphosphorylamino)-1,3-diphenylpropan-1-ol |
| SMILES | O=P(N[C@@H](Cc1ccccc1)[C@H](O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26NO2P/c29-27(23-15-7-2-8-16-23)26(21-22-13-5-1-6-14-22)28-31(30,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20,26-27,29H,21H2,(H,28,30)/t26-,27+/m0/s1 |
| InChIKey | HHQMJWANLJPJHD-RRPNLBNLSA-N |
| XLogP | 4.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|