C17H22NO2P — CID 23241768
2-(diphenylphosphorylamino)-3-methylbutan-1-ol (PubChem CID 23241768) has the molecular formula C17H22NO2P and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-(diphenylphosphorylamino)-3-methylbutan-1-ol.
| Compound Name | 2-(diphenylphosphorylamino)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 23241768 |
| Molecular Formula | C17H22NO2P |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-(diphenylphosphorylamino)-3-methylbutan-1-ol |
| SMILES | CC(C)C(CO)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H22NO2P/c1-14(2)17(13-19)18-21(20,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17,19H,13H2,1-2H3,(H,18,20) |
| InChIKey | AMVSHUAKPYPDBJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|