C21H22NOP — CID 72834270
N-diphenylphosphoryl-1-(4-methylphenyl)ethanamine (PubChem CID 72834270) has the molecular formula C21H22NOP and a molecular weight of 335.39 g/mol. Its IUPAC name is N-diphenylphosphoryl-1-(4-methylphenyl)ethanamine.
| Compound Name | N-diphenylphosphoryl-1-(4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 72834270 |
| Molecular Formula | C21H22NOP |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-diphenylphosphoryl-1-(4-methylphenyl)ethanamine |
| SMILES | Cc1ccc(C(C)NP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22NOP/c1-17-13-15-19(16-14-17)18(2)22-24(23,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,18H,1-2H3,(H,22,23) |
| InChIKey | TVNUHJHYMDNSRE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|