C33H33N2O3P — CID 102293777
(5R)-5-[(S)-(diphenylphosphorylamino)-(4-methylphenyl)methyl]-5-(2-methylpropyl)-2-phenyl-1,3-oxazol-4-one (PubChem CID 102293777) has the molecular formula C33H33N2O3P and a molecular weight of 536.61 g/mol. Its IUPAC name is (5R)-5-[(S)-(diphenylphosphorylamino)-(4-methylphenyl)methyl]-5-(2-methylpropyl)-2-phenyl-1,3-oxazol-4-one.
| Compound Name | (5R)-5-[(S)-(diphenylphosphorylamino)-(4-methylphenyl)methyl]-5-(2-methylpropyl)-2-phenyl-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 102293777 |
| Molecular Formula | C33H33N2O3P |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (5R)-5-[(S)-(diphenylphosphorylamino)-(4-methylphenyl)methyl]-5-(2-methylpropyl)-2-phenyl-1,3-oxazol-4-one |
| SMILES | Cc1ccc([C@H](NP(=O)(c2ccccc2)c2ccccc2)[C@@]2(CC(C)C)OC(c3ccccc3)=NC2=O)cc1 |
| InChI | InChI=1S/C33H33N2O3P/c1-24(2)23-33(32(36)34-31(38-33)27-13-7-4-8-14-27)30(26-21-19-25(3)20-22-26)35-39(37,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22,24,30H,23H2,1-3H3,(H,35,37)/t30-,33+/m0/s1 |
| InChIKey | RFSHQZAMUPQHMS-BZKUTMRRSA-N |
| XLogP | 6.34 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|