C28H27N — CID 173154873
4-methyl-N-(4-methylphenyl)-N-[1-(4-phenylphenyl)ethyl]aniline (PubChem CID 173154873) has the molecular formula C28H27N and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)-N-[1-(4-phenylphenyl)ethyl]aniline.
| Compound Name | 4-methyl-N-(4-methylphenyl)-N-[1-(4-phenylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 173154873 |
| Molecular Formula | C28H27N |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)-N-[1-(4-phenylphenyl)ethyl]aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)C(C)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H27N/c1-21-9-17-27(18-10-21)29(28-19-11-22(2)12-20-28)23(3)24-13-15-26(16-14-24)25-7-5-4-6-8-25/h4-20,23H,1-3H3 |
| InChIKey | CZUREXLLEUSSTH-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |