C20H20N2 — CID 67775594
4-N-phenyl-4-N-(1-phenylethyl)benzene-1,4-diamine (PubChem CID 67775594) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-N-phenyl-4-N-(1-phenylethyl)benzene-1,4-diamine.
| Compound Name | 4-N-phenyl-4-N-(1-phenylethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 67775594 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-N-phenyl-4-N-(1-phenylethyl)benzene-1,4-diamine |
| SMILES | CC(c1ccccc1)N(c1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C20H20N2/c1-16(17-8-4-2-5-9-17)22(19-10-6-3-7-11-19)20-14-12-18(21)13-15-20/h2-16H,21H2,1H3 |
| InChIKey | WDZLHEZDMLOIOQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|