C28H28N2 — CID 139888641
(2R,3R)-2-N,2-N,3-N,3-N-tetraphenylbutane-2,3-diamine (PubChem CID 139888641) has the molecular formula C28H28N2 and a molecular weight of 392.55 g/mol. Its IUPAC name is (2R,3R)-2-N,2-N,3-N,3-N-tetraphenylbutane-2,3-diamine.
| Compound Name | (2R,3R)-2-N,2-N,3-N,3-N-tetraphenylbutane-2,3-diamine |
|---|---|
| PubChem CID | 139888641 |
| Molecular Formula | C28H28N2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | (2R,3R)-2-N,2-N,3-N,3-N-tetraphenylbutane-2,3-diamine |
| SMILES | C[C@H]([C@@H](C)N(c1ccccc1)c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28N2/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-24H,1-2H3/t23-,24-/m1/s1 |
| InChIKey | HFQFWTHAYVYPNJ-DNQXCXABSA-N |
| XLogP | 7.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |