C27H24N2O — CID 141093268
1,1-bis(N-phenylanilino)propan-2-one (PubChem CID 141093268) has the molecular formula C27H24N2O and a molecular weight of 392.50 g/mol. Its IUPAC name is 1,1-bis(N-phenylanilino)propan-2-one.
| Compound Name | 1,1-bis(N-phenylanilino)propan-2-one |
|---|---|
| PubChem CID | 141093268 |
| Molecular Formula | C27H24N2O |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 1,1-bis(N-phenylanilino)propan-2-one |
| SMILES | CC(=O)C(N(c1ccccc1)c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H24N2O/c1-22(30)27(28(23-14-6-2-7-15-23)24-16-8-3-9-17-24)29(25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-21,27H,1H3 |
| InChIKey | KJKWZWQKJQHOAH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|