C23H26O4 — CID 144916129
2-methyl-5-methylidene-2-(2-methylpropyl)-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene (PubChem CID 144916129) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-methyl-5-methylidene-2-(2-methylpropyl)-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene.
| Compound Name | 2-methyl-5-methylidene-2-(2-methylpropyl)-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene |
|---|---|
| PubChem CID | 144916129 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-methyl-5-methylidene-2-(2-methylpropyl)-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene |
| SMILES | C=C1C(=O)OC(C)(CC(C)C)OC1=O.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C10H14O4/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-6(2)5-10(4)13-8(11)7(3)9(12)14-10/h2-10H,1H3;6H,3,5H2,1-2,4H3 |
| InChIKey | ARNMBLDCCRALQG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|