About 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene
2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene (PubChem CID 144916102) has the molecular formula C25H30O4
and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene.
Molecular Properties
| Compound Name | 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene |
| PubChem CID | 144916102 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene |
| SMILES | C=C1C(=O)OC(C)(CCCCCC)OC1=O.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C12H18O4/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-4-5-6-7-8-12(3)15-10(13)9(2)11(14)16-12/h2-10H,1H3;2,4-8H2,1,3H3 |
| InChIKey | KLOOJQXPTDXUMK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene?
The IUPAC name of 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene (CID 144916102) is 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene.
What is the SMILES notation for 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene?
The canonical SMILES for 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene is C=C1C(=O)OC(C)(CCCCCC)OC1=O.Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene?
The InChIKey is KLOOJQXPTDXUMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C12H18O4/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-4-5-6-7-8-12(3)15-10(13)9(2)11(14)16-12/h2-10H,1H3;2,4-8H2,1,3H3.
What are the key properties of 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene?
2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene has a molecular weight of 394.51 g/mol, XLogP of 5.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-2-methyl-5-methylidene-1,3-dioxane-4,6-dione;1-methyl-4-phenylbenzene is sourced from PubChem (CID 144916102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).