C15H24O4 — CID 139694653
5-methylidene-2,2-dipentyl-1,3-dioxane-4,6-dione (PubChem CID 139694653) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 5-methylidene-2,2-dipentyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-methylidene-2,2-dipentyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 139694653 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5-methylidene-2,2-dipentyl-1,3-dioxane-4,6-dione |
| SMILES | C=C1C(=O)OC(CCCCC)(CCCCC)OC1=O |
| InChI | InChI=1S/C15H24O4/c1-4-6-8-10-15(11-9-7-5-2)18-13(16)12(3)14(17)19-15/h3-11H2,1-2H3 |
| InChIKey | MPCGZADNWPBTQW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|