C7H12O4 — CID 142638506
4-hydroxy-4-pentyl-1,3-dioxetan-2-one (PubChem CID 142638506) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 4-hydroxy-4-pentyl-1,3-dioxetan-2-one.
| Compound Name | 4-hydroxy-4-pentyl-1,3-dioxetan-2-one |
|---|---|
| PubChem CID | 142638506 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 4-hydroxy-4-pentyl-1,3-dioxetan-2-one |
| SMILES | CCCCCC1(O)OC(=O)O1 |
| InChI | InChI=1S/C7H12O4/c1-2-3-4-5-7(9)10-6(8)11-7/h9H,2-5H2,1H3 |
| InChIKey | KIVPWUUHFLOMMA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|