C18H33NO3 — CID 139791197
3-hydroxy-3-tetradecylpyrrolidine-2,5-dione (PubChem CID 139791197) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is 3-hydroxy-3-tetradecylpyrrolidine-2,5-dione.
| Compound Name | 3-hydroxy-3-tetradecylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139791197 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | 3-hydroxy-3-tetradecylpyrrolidine-2,5-dione |
| SMILES | CCCCCCCCCCCCCCC1(O)CC(=O)NC1=O |
| InChI | InChI=1S/C18H33NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18(22)15-16(20)19-17(18)21/h22H,2-15H2,1H3,(H,19,20,21) |
| InChIKey | VOLZWUODEPKQFX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|