C10H16O5 — CID 139642366
2-hydroxy-2-propyl-1,3-dioxonane-4,9-dione (PubChem CID 139642366) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-hydroxy-2-propyl-1,3-dioxonane-4,9-dione.
| Compound Name | 2-hydroxy-2-propyl-1,3-dioxonane-4,9-dione |
|---|---|
| PubChem CID | 139642366 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-hydroxy-2-propyl-1,3-dioxonane-4,9-dione |
| SMILES | CCCC1(O)OC(=O)CCCCC(=O)O1 |
| InChI | InChI=1S/C10H16O5/c1-2-7-10(13)14-8(11)5-3-4-6-9(12)15-10/h13H,2-7H2,1H3 |
| InChIKey | AYNACMJFEWZXBW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |