C13H24O2 — CID 10822452
6,6-dibutyloxan-2-one (PubChem CID 10822452) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 6,6-dibutyloxan-2-one.
| Compound Name | 6,6-dibutyloxan-2-one |
|---|---|
| PubChem CID | 10822452 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 6,6-dibutyloxan-2-one |
| SMILES | CCCCC1(CCCC)CCCC(=O)O1 |
| InChI | InChI=1S/C13H24O2/c1-3-5-9-13(10-6-4-2)11-7-8-12(14)15-13/h3-11H2,1-2H3 |
| InChIKey | RAYKYSFPVPDJKX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |