About 6,6-dibutyloxan-2-one
6,6-dibutyloxan-2-one (PubChem CID 10822452) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 6,6-dibutyloxan-2-one.
Molecular Properties
| Compound Name | 6,6-dibutyloxan-2-one |
| PubChem CID | 10822452 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 6,6-dibutyloxan-2-one |
| SMILES | CCCCC1(CCCC)CCCC(=O)O1 |
| InChI | InChI=1S/C13H24O2/c1-3-5-9-13(10-6-4-2)11-7-8-12(14)15-13/h3-11H2,1-2H3 |
| InChIKey | RAYKYSFPVPDJKX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dibutyloxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dibutyloxan-2-one?
The IUPAC name of 6,6-dibutyloxan-2-one (CID 10822452) is 6,6-dibutyloxan-2-one.
What is the SMILES notation for 6,6-dibutyloxan-2-one?
The canonical SMILES for 6,6-dibutyloxan-2-one is CCCCC1(CCCC)CCCC(=O)O1.
What is the InChIKey of 6,6-dibutyloxan-2-one?
The InChIKey is RAYKYSFPVPDJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-3-5-9-13(10-6-4-2)11-7-8-12(14)15-13/h3-11H2,1-2H3.
What are the key properties of 6,6-dibutyloxan-2-one?
6,6-dibutyloxan-2-one has a molecular weight of 212.33 g/mol, XLogP of 3.83, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dibutyloxan-2-one is sourced from PubChem (CID 10822452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).